C27H40O7S — CID 167566007
[(2S,4S,5S)-2-[(3S,4S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methylphenyl)sulfanyloxan-4-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 167566007) has the molecular formula C27H40O7S and a molecular weight of 508.68 g/mol. Its IUPAC name is [(2S,4S,5S)-2-[(3S,4S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methylphenyl)sulfanyloxan-4-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,4S,5S)-2-[(3S,4S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methylphenyl)sulfanyloxan-4-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 167566007 |
| Molecular Formula | C27H40O7S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [(2S,4S,5S)-2-[(3S,4S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methylphenyl)sulfanyloxan-4-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@@H](O[C@@H]2C(OC(C)=O)[C@H](Sc3ccc(C)cc3)OC(C)[C@@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C27H40O7S/c1-9-22-15(3)16(4)24(31-19(7)28)26(33-22)34-23-17(5)18(6)30-27(25(23)32-20(8)29)35-21-12-10-14(2)11-13-21/h10-13,15-18,22-27H,9H2,1-8H3/t15-,16-,17-,18?,22?,23-,24?,25?,26-,27-/m0/s1 |
| InChIKey | ONTYQINUAFTQOQ-ZDBJGYEQSA-N |
| XLogP | 5.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |