C25H40O4S — CID 121288481
(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-(4-methylphenyl)sulfanyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol (PubChem CID 121288481) has the molecular formula C25H40O4S and a molecular weight of 436.66 g/mol. Its IUPAC name is (2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-(4-methylphenyl)sulfanyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol.
| Compound Name | (2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-(4-methylphenyl)sulfanyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 121288481 |
| Molecular Formula | C25H40O4S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-(4-methylphenyl)sulfanyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol |
| SMILES | CCC1O[C@H](OC2[C@@H](Sc3ccc(C)cc3)OC(CC)[C@@H](C)[C@@H]2C)C(O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H40O4S/c1-8-20-15(4)17(6)22(26)24(27-20)29-23-18(7)16(5)21(9-2)28-25(23)30-19-12-10-14(3)11-13-19/h10-13,15-18,20-26H,8-9H2,1-7H3/t15-,16-,17-,18-,20?,21?,22?,23?,24+,25+/m0/s1 |
| InChIKey | QQRHTTJAOWYFGF-IGBRCPSISA-N |
| XLogP | 5.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |