C15H28O6 — CID 126492470
(2R,4S,5R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyoxane-2,3,5-triol (PubChem CID 126492470) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is (2R,4S,5R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyoxane-2,3,5-triol.
| Compound Name | (2R,4S,5R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyoxane-2,3,5-triol |
|---|---|
| PubChem CID | 126492470 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (2R,4S,5R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyoxane-2,3,5-triol |
| SMILES | CCC1O[C@@H](O[C@@H]2C(O)[C@H](O)OC[C@H]2O)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C15H28O6/c1-5-11-8(3)7(2)9(4)15(20-11)21-13-10(16)6-19-14(18)12(13)17/h7-18H,5-6H2,1-4H3/t7-,8+,9?,10+,11?,12?,13-,14+,15-/m0/s1 |
| InChIKey | RPPJPROWIXJLJQ-BARJBYGSSA-N |
| XLogP | 0.49 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |