C29H54O5 — CID 161084104
(2S,3S,5R)-6-ethyl-3-[(1R,4R)-5-ethyl-2,3,4-trimethylcyclohexyl]oxy-4-[(2S,3S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-5-methyloxan-2-ol (PubChem CID 161084104) has the molecular formula C29H54O5 and a molecular weight of 482.75 g/mol. Its IUPAC name is (2S,3S,5R)-6-ethyl-3-[(1R,4R)-5-ethyl-2,3,4-trimethylcyclohexyl]oxy-4-[(2S,3S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-5-methyloxan-2-ol.
| Compound Name | (2S,3S,5R)-6-ethyl-3-[(1R,4R)-5-ethyl-2,3,4-trimethylcyclohexyl]oxy-4-[(2S,3S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-5-methyloxan-2-ol |
|---|---|
| PubChem CID | 161084104 |
| Molecular Formula | C29H54O5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | (2S,3S,5R)-6-ethyl-3-[(1R,4R)-5-ethyl-2,3,4-trimethylcyclohexyl]oxy-4-[(2S,3S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-5-methyloxan-2-ol |
| SMILES | CCC1C[C@@H](O[C@H]2C(O[C@@H]3OC(CC)[C@@H](C)C(C)[C@@H]3C)[C@H](C)C(CC)O[C@@H]2O)C(C)C(C)[C@@H]1C |
| InChI | InChI=1S/C29H54O5/c1-11-22-14-25(19(8)15(4)17(22)6)31-27-26(21(10)24(13-3)32-28(27)30)34-29-20(9)16(5)18(7)23(12-2)33-29/h15-30H,11-14H2,1-10H3/t15?,16?,17-,18-,19?,20-,21+,22?,23?,24?,25+,26?,27-,28-,29-/m0/s1 |
| InChIKey | UGGYLAJESHGMAJ-IDKLORSZSA-N |
| XLogP | 6.27 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |