C32H60O5 — CID 134169133
(2S,3R,4S,5R,6R)-2-tert-butyl-6-ethyl-3,4-bis[[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy]-5-methyloxane (PubChem CID 134169133) has the molecular formula C32H60O5 and a molecular weight of 524.83 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-tert-butyl-6-ethyl-3,4-bis[[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy]-5-methyloxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-tert-butyl-6-ethyl-3,4-bis[[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy]-5-methyloxane |
|---|---|
| PubChem CID | 134169133 |
| Molecular Formula | C32H60O5 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.44 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-tert-butyl-6-ethyl-3,4-bis[[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy]-5-methyloxane |
| SMILES | CC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[C@@H]3O[C@H](CC)[C@@H](C)[C@H](C)[C@H]3C)[C@H](C)[C@@H](CC)O[C@H]2C(C)(C)C)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C32H60O5/c1-14-24-19(6)17(4)21(8)30(34-24)36-27-23(10)26(16-3)33-29(32(11,12)13)28(27)37-31-22(9)18(5)20(7)25(15-2)35-31/h17-31H,14-16H2,1-13H3/t17-,18-,19-,20-,21+,22+,23+,24+,25+,26+,27-,28+,29+,30-,31-/m0/s1 |
| InChIKey | VKUGXJFORQUFTB-BTLYHRMOSA-N |
| XLogP | 7.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |