C12H17BrO6 — CID 165082447
[(2R,3S,4R,5R,6R)-2-acetyl-5-acetyloxy-6-bromo-3-methyloxan-4-yl] acetate (PubChem CID 165082447) has the molecular formula C12H17BrO6 and a molecular weight of 337.17 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2-acetyl-5-acetyloxy-6-bromo-3-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2-acetyl-5-acetyloxy-6-bromo-3-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 165082447 |
| Molecular Formula | C12H17BrO6 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2-acetyl-5-acetyloxy-6-bromo-3-methyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)[C@H](C(C)=O)O[C@H](Br)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H17BrO6/c1-5-9(6(2)14)19-12(13)11(18-8(4)16)10(5)17-7(3)15/h5,9-12H,1-4H3/t5-,9-,10-,11-,12+/m1/s1 |
| InChIKey | HJKCUJRAYTXWES-OTDSITQLSA-N |
| XLogP | 1.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|