C9H15BrO3 — CID 58265385
[(2R,3R,4S,5S)-2-bromo-4,5-dimethyloxan-3-yl] acetate (PubChem CID 58265385) has the molecular formula C9H15BrO3 and a molecular weight of 251.12 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-bromo-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2-bromo-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58265385 |
| Molecular Formula | C9H15BrO3 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | [(2R,3R,4S,5S)-2-bromo-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](C)[C@H](C)CO[C@@H]1Br |
| InChI | InChI=1S/C9H15BrO3/c1-5-4-12-9(10)8(6(5)2)13-7(3)11/h5-6,8-9H,4H2,1-3H3/t5-,6+,8-,9+/m1/s1 |
| InChIKey | PBTSVQMJVZRGHV-BUVSBJAHSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|