C10H15NO3S — CID 157108957
[(2S,3S,4R,5S)-2-isothiocyanato-4,5-dimethyloxan-3-yl] acetate (PubChem CID 157108957) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-2-isothiocyanato-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5S)-2-isothiocyanato-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 157108957 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | [(2S,3S,4R,5S)-2-isothiocyanato-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)[C@H](C)CO[C@@H]1N=C=S |
| InChI | InChI=1S/C10H15NO3S/c1-6-4-13-10(11-5-15)9(7(6)2)14-8(3)12/h6-7,9-10H,4H2,1-3H3/t6-,7-,9+,10+/m1/s1 |
| InChIKey | QIWAQXOLZGDYPI-XFFJFQIUSA-N |
| XLogP | 1.65 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|