C12H15NO7S — CID 141226202
[(3R,4S,5R)-4,5-bis[(2-deuterioacetyl)oxy]-6-isothiocyanatooxan-3-yl] 2-deuterioacetate (PubChem CID 141226202) has the molecular formula C12H15NO7S and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-bis[(2-deuterioacetyl)oxy]-6-isothiocyanatooxan-3-yl] 2-deuterioacetate.
| Compound Name | [(3R,4S,5R)-4,5-bis[(2-deuterioacetyl)oxy]-6-isothiocyanatooxan-3-yl] 2-deuterioacetate |
|---|---|
| PubChem CID | 141226202 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(3R,4S,5R)-4,5-bis[(2-deuterioacetyl)oxy]-6-isothiocyanatooxan-3-yl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)O[C@H]1[C@H](OC(=O)C[2H])COC(N=C=S)[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C12H15NO7S/c1-6(14)18-9-4-17-12(13-5-21)11(20-8(3)16)10(9)19-7(2)15/h9-12H,4H2,1-3H3/t9-,10+,11-,12?/m1/s1/i1D,2D,3D |
| InChIKey | RCHZRAFPHKCWRI-XLMXXHLWSA-N |
| XLogP | 0.24 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|