C12H18O7S2 — CID 162510937
[(3S,5S,6S)-4,5-diacetyloxy-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate (PubChem CID 162510937) has the molecular formula C12H18O7S2 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(3S,5S,6S)-4,5-diacetyloxy-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate.
| Compound Name | [(3S,5S,6S)-4,5-diacetyloxy-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162510937 |
| Molecular Formula | C12H18O7S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(3S,5S,6S)-4,5-diacetyloxy-6-(sulfanylmethylsulfanyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](OC(C)=O)CO[C@@H](SCS)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H18O7S2/c1-6(13)17-9-4-16-12(21-5-20)11(19-8(3)15)10(9)18-7(2)14/h9-12,20H,4-5H2,1-3H3/t9-,10?,11-,12-/m0/s1 |
| InChIKey | JRQBIOKBSFUVCE-XHGCHNAGSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|