C11H15BrO7 — CID 134859457
[(3S,6R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate (PubChem CID 134859457) has the molecular formula C11H15BrO7 and a molecular weight of 339.14 g/mol. Its IUPAC name is [(3S,6R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate.
| Compound Name | [(3S,6R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate |
|---|---|
| PubChem CID | 134859457 |
| Molecular Formula | C11H15BrO7 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | [(3S,6R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@@H](Br)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H15BrO7/c1-5(13)17-8-4-16-11(12)10(19-7(3)15)9(8)18-6(2)14/h8-11H,4H2,1-3H3/t8-,9?,10?,11-/m0/s1 |
| InChIKey | AVNRQUICFRHQDY-PMUOWJKOSA-N |
| XLogP | 0.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|