C13H18O9 — CID 100924415
methyl (2R,3S,4S,5R)-3,4,5-triacetyloxyoxane-2-carboxylate (PubChem CID 100924415) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-3,4,5-triacetyloxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R)-3,4,5-triacetyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 100924415 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | methyl (2R,3S,4S,5R)-3,4,5-triacetyloxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H18O9/c1-6(14)20-9-5-19-12(13(17)18-4)11(22-8(3)16)10(9)21-7(2)15/h9-12H,5H2,1-4H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | QJTZNWRABBGSCY-NOOOWODRSA-N |
| XLogP | -0.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|