C11H18O7 — CID 22212825
[(3R,4S,5R,6S)-5-acetyloxy-4,6-dimethoxyoxan-3-yl] acetate (PubChem CID 22212825) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-5-acetyloxy-4,6-dimethoxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-5-acetyloxy-4,6-dimethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 22212825 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [(3R,4S,5R,6S)-5-acetyloxy-4,6-dimethoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1OC[C@@H](OC(C)=O)[C@H](OC)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H18O7/c1-6(12)17-8-5-16-11(15-4)10(9(8)14-3)18-7(2)13/h8-11H,5H2,1-4H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | FPNICPYQAWTZRW-YTWAJWBKSA-N |
| XLogP | -0.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |