C15H22O10 — CID 102331148
dimethyl 2-[(2R,3S,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]propanedioate (PubChem CID 102331148) has the molecular formula C15H22O10 and a molecular weight of 362.33 g/mol. Its IUPAC name is dimethyl 2-[(2R,3S,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,3S,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]propanedioate |
|---|---|
| PubChem CID | 102331148 |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | dimethyl 2-[(2R,3S,4S,5R)-4,5-diacetyloxy-2-methoxyoxan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1[C@H](OC)OC[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O10/c1-7(16)24-9-6-23-15(22-5)10(12(9)25-8(2)17)11(13(18)20-3)14(19)21-4/h9-12,15H,6H2,1-5H3/t9-,10+,12-,15-/m1/s1 |
| InChIKey | XTXMZFIWCATISB-KVQFHVITSA-N |
| XLogP | -0.57 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|