C18H26O12 — CID 134833645
dimethyl 2-[(2R,5S)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]propanedioate (PubChem CID 134833645) has the molecular formula C18H26O12 and a molecular weight of 434.39 g/mol. Its IUPAC name is dimethyl 2-[(2R,5S)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,5S)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]propanedioate |
|---|---|
| PubChem CID | 134833645 |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | dimethyl 2-[(2R,5S)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1C(OC(C)=O)[C@H](OC(C)=O)C(COC(C)=O)O[C@H]1OC |
| InChI | InChI=1S/C18H26O12/c1-8(19)27-7-11-14(28-9(2)20)15(29-10(3)21)12(18(26-6)30-11)13(16(22)24-4)17(23)25-5/h11-15,18H,7H2,1-6H3/t11?,12?,14-,15?,18-/m1/s1 |
| InChIKey | DGHSPRYAFRRPTM-QDAROJAPSA-N |
| XLogP | -0.64 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|