C10H18O5 — CID 101103796
[(2S,3S,4S,5S)-4,5-dimethoxy-2-methyloxan-3-yl] acetate (PubChem CID 101103796) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-4,5-dimethoxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5S)-4,5-dimethoxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101103796 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(2S,3S,4S,5S)-4,5-dimethoxy-2-methyloxan-3-yl] acetate |
| SMILES | CO[C@@H]1[C@@H](OC(C)=O)[C@H](C)OC[C@@H]1OC |
| InChI | InChI=1S/C10H18O5/c1-6-9(15-7(2)11)10(13-4)8(12-3)5-14-6/h6,8-10H,5H2,1-4H3/t6-,8-,9-,10-/m0/s1 |
| InChIKey | OXXJBRPRCDPQNS-LKEDHPFLSA-N |
| XLogP | 0.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |