C13H24O6 — CID 16745162
[(2R,3R,4R,5S)-4,5-dimethoxy-2-(propoxymethyl)oxan-3-yl] acetate (PubChem CID 16745162) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4,5-dimethoxy-2-(propoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-4,5-dimethoxy-2-(propoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 16745162 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [(2R,3R,4R,5S)-4,5-dimethoxy-2-(propoxymethyl)oxan-3-yl] acetate |
| SMILES | CCCOC[C@H]1OC[C@H](OC)[C@@H](OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H24O6/c1-5-6-17-7-11-13(19-9(2)14)12(16-4)10(15-3)8-18-11/h10-13H,5-8H2,1-4H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | DRDBNTRWWGXMFB-UMSGYPCISA-N |
| XLogP | 0.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|