C12H20O7 — CID 91747030
[(2S,3R,4R,5R)-5-acetyloxy-3,4-dimethoxyoxan-2-yl]methyl acetate (PubChem CID 91747030) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-acetyloxy-3,4-dimethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R)-5-acetyloxy-3,4-dimethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91747030 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(2S,3R,4R,5R)-5-acetyloxy-3,4-dimethoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1[C@H](OC)[C@H](OC(C)=O)CO[C@H]1COC(C)=O |
| InChI | InChI=1S/C12H20O7/c1-7(13)17-5-9-11(15-3)12(16-4)10(6-18-9)19-8(2)14/h9-12H,5-6H2,1-4H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | ZIVZYLQMQYPARL-IRCOFANPSA-N |
| XLogP | -0.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |