C12H18O7 — CID 168951492
[(4S)-3,4-diacetyloxyoxan-2-yl]methyl acetate (PubChem CID 168951492) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is [(4S)-3,4-diacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(4S)-3,4-diacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 168951492 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(4S)-3,4-diacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OCC[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C12H18O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h10-12H,4-6H2,1-3H3/t10-,11?,12?/m0/s1 |
| InChIKey | PSZAVEQFKUJAJK-UNXYVOJBSA-N |
| XLogP | 0.20 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|