C15H22O9 — CID 550322
[4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate (PubChem CID 550322) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 550322 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC(OC(C)=O)C(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C15H22O9/c1-8(16)20-6-12-5-13(22-10(3)18)15(23-11(4)19)14(24-12)7-21-9(2)17/h12-15H,5-7H2,1-4H3 |
| InChIKey | BWUOHRDTHUBKLA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|