C15H24O7 — CID 177338031
(3,4-diacetyloxy-6-propan-2-yloxan-2-yl)methyl acetate (PubChem CID 177338031) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is (3,4-diacetyloxy-6-propan-2-yloxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-6-propan-2-yloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 177338031 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3,4-diacetyloxy-6-propan-2-yloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(C(C)C)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H24O7/c1-8(2)12-6-13(20-10(4)17)15(21-11(5)18)14(22-12)7-19-9(3)16/h8,12-15H,6-7H2,1-5H3 |
| InChIKey | FRYIRARTWWWFDP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|