C17H26O9 — CID 135223999
[(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methyl acetate (PubChem CID 135223999) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135223999 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(C(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26O9/c1-8(2)14-16(24-11(5)20)17(25-12(6)21)15(23-10(4)19)13(26-14)7-22-9(3)18/h8,13-17H,7H2,1-6H3/t13-,14?,15-,16-,17+/m0/s1 |
| InChIKey | RQHCFBQOOMMKGO-BWNFHQQQSA-N |
| XLogP | 0.77 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|