C17H25IO9 — CID 102161464
[(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-(2-iodopropyl)oxan-2-yl]methyl acetate (PubChem CID 102161464) has the molecular formula C17H25IO9 and a molecular weight of 500.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-(2-iodopropyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-(2-iodopropyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102161464 |
| Molecular Formula | C17H25IO9 |
| Molecular Weight | 500.28 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-(2-iodopropyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(C)I)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H25IO9/c1-8(18)6-13-15(24-10(3)20)17(26-12(5)22)16(25-11(4)21)14(27-13)7-23-9(2)19/h8,13-17H,6-7H2,1-5H3/t8?,13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | LGALEYUNCGHBQV-XJNPXFOASA-N |
| XLogP | 1.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|