C14H21NO8 — CID 139093780
[(2S,3R,4S,5S)-3-acetamido-4,5-diacetyloxyoxan-2-yl]methyl acetate (PubChem CID 139093780) has the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3-acetamido-4,5-diacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S)-3-acetamido-4,5-diacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139093780 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(2S,3R,4S,5S)-3-acetamido-4,5-diacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)CO[C@@H]1COC(C)=O |
| InChI | InChI=1S/C14H21NO8/c1-7(16)15-13-11(5-20-8(2)17)21-6-12(22-9(3)18)14(13)23-10(4)19/h11-14H,5-6H2,1-4H3,(H,15,16)/t11-,12+,13-,14-/m1/s1 |
| InChIKey | UBSQULLFKWWEPL-XJFOESAGSA-N |
| XLogP | -0.68 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|