C16H29NO6 — CID 160503920
[(6S)-5-acetamido-3-acetyloxy-4,6-dimethyloxan-2-yl]methyl acetate;ethane (PubChem CID 160503920) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is [(6S)-5-acetamido-3-acetyloxy-4,6-dimethyloxan-2-yl]methyl acetate;ethane.
| Compound Name | [(6S)-5-acetamido-3-acetyloxy-4,6-dimethyloxan-2-yl]methyl acetate;ethane |
|---|---|
| PubChem CID | 160503920 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | [(6S)-5-acetamido-3-acetyloxy-4,6-dimethyloxan-2-yl]methyl acetate;ethane |
| SMILES | CC.CC(=O)NC1C(C)C(OC(C)=O)C(COC(C)=O)O[C@H]1C |
| InChI | InChI=1S/C14H23NO6.C2H6/c1-7-13(15-9(3)16)8(2)20-12(6-19-10(4)17)14(7)21-11(5)18;1-2/h7-8,12-14H,6H2,1-5H3,(H,15,16);1-2H3/t7?,8-,12?,13?,14?;/m0./s1 |
| InChIKey | QSDICHBQXNOOPI-BUEGCVGKSA-N |
| XLogP | 1.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |