C13H21NO9 — CID 130375689
[(3S,5S,6R)-5-acetamido-6-acetyloxy-4-methyl-3-(trioxidanyl)oxan-2-yl]methyl acetate (PubChem CID 130375689) has the molecular formula C13H21NO9 and a molecular weight of 335.31 g/mol. Its IUPAC name is [(3S,5S,6R)-5-acetamido-6-acetyloxy-4-methyl-3-(trioxidanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S,6R)-5-acetamido-6-acetyloxy-4-methyl-3-(trioxidanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130375689 |
| Molecular Formula | C13H21NO9 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [(3S,5S,6R)-5-acetamido-6-acetyloxy-4-methyl-3-(trioxidanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1C(C)[C@H](OOO)C(COC(C)=O)O[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H21NO9/c1-6-11(14-7(2)15)13(20-9(4)17)21-10(5-19-8(3)16)12(6)22-23-18/h6,10-13,18H,5H2,1-4H3,(H,14,15)/t6?,10?,11-,12-,13-/m0/s1 |
| InChIKey | VBYZJZHSZSVRCX-CSDDNQHPSA-N |
| XLogP | -0.23 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|