C16H23NO10 — CID 548258
(4-acetamido-3,5,6-triacetyloxyoxan-2-yl)methyl acetate (PubChem CID 548258) has the molecular formula C16H23NO10 and a molecular weight of 389.36 g/mol. Its IUPAC name is (4-acetamido-3,5,6-triacetyloxyoxan-2-yl)methyl acetate.
| Compound Name | (4-acetamido-3,5,6-triacetyloxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 548258 |
| Molecular Formula | C16H23NO10 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (4-acetamido-3,5,6-triacetyloxyoxan-2-yl)methyl acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)C(COC(C)=O)OC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H23NO10/c1-7(18)17-13-14(24-9(3)20)12(6-23-8(2)19)27-16(26-11(5)22)15(13)25-10(4)21/h12-16H,6H2,1-5H3,(H,17,18) |
| InChIKey | DFTAHEWBJYDOLQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|