C15H24N2O8 — CID 22215456
[(2R,3S,4R,5R,6R)-4,5-diacetamido-3-acetyloxy-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 22215456) has the molecular formula C15H24N2O8 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4,5-diacetamido-3-acetyloxy-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-4,5-diacetamido-3-acetyloxy-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22215456 |
| Molecular Formula | C15H24N2O8 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4,5-diacetamido-3-acetyloxy-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](NC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C15H24N2O8/c1-7(18)16-12-13(17-8(2)19)15(22-5)25-11(6-23-9(3)20)14(12)24-10(4)21/h11-15H,6H2,1-5H3,(H,16,18)(H,17,19)/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | WYSSOIASTRXWRV-KJWHEZOQSA-N |
| XLogP | -1.14 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |