C16H25NO8 — CID 163977014
[(2R,4R,5R)-5-acetamido-3-acetyloxy-4-methyl-6-(2-oxoethoxymethyl)oxan-2-yl]methyl acetate (PubChem CID 163977014) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is [(2R,4R,5R)-5-acetamido-3-acetyloxy-4-methyl-6-(2-oxoethoxymethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,4R,5R)-5-acetamido-3-acetyloxy-4-methyl-6-(2-oxoethoxymethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163977014 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [(2R,4R,5R)-5-acetamido-3-acetyloxy-4-methyl-6-(2-oxoethoxymethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1C(COCC=O)O[C@H](COC(C)=O)C(OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C16H25NO8/c1-9-15(17-10(2)19)13(7-22-6-5-18)25-14(8-23-11(3)20)16(9)24-12(4)21/h5,9,13-16H,6-8H2,1-4H3,(H,17,19)/t9-,13?,14-,15-,16?/m1/s1 |
| InChIKey | SVBDANCSNAXEQK-IFGUQGGKSA-N |
| XLogP | -0.40 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|