C14H22O9 — CID 135193868
[(2R,3R,5S)-3,4-diacetyloxy-5-(1-hydroxyethoxy)oxan-2-yl]methyl acetate (PubChem CID 135193868) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is [(2R,3R,5S)-3,4-diacetyloxy-5-(1-hydroxyethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5S)-3,4-diacetyloxy-5-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135193868 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(2R,3R,5S)-3,4-diacetyloxy-5-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC[C@H](OC(C)O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H22O9/c1-7(15)19-5-11-13(22-9(3)17)14(23-10(4)18)12(6-20-11)21-8(2)16/h8,11-14,16H,5-6H2,1-4H3/t8?,11-,12+,13-,14?/m1/s1 |
| InChIKey | HEOALFYMQYEKAT-OOKHESETSA-N |
| XLogP | -0.46 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|