C14H20O9 — CID 139782838
[(2R,3R,4R,5S)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 139782838) has the molecular formula C14H20O9 and a molecular weight of 336.33 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 139782838 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C14H20O9/c1-7(15)19-5-11-13(22-9(3)17)14(23-10(4)18)12(6-20-11)21-8(2)16/h11-14H,5-6H2,1-4H3/t11-,12+,13-,14-/m1/s1/i1D,2D,3D,4D |
| InChIKey | ULWHEXUWXLOVPV-BQFYTNPGSA-N |
| XLogP | -0.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|