C17H24O10 — CID 139627234
[(2R,3S,4S,5R)-3,4,6-tris[(2-deuterioacetyl)oxy]-5-prop-2-enoxyoxan-2-yl]methyl 2-deuterioacetate (PubChem CID 139627234) has the molecular formula C17H24O10 and a molecular weight of 392.39 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,6-tris[(2-deuterioacetyl)oxy]-5-prop-2-enoxyoxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,6-tris[(2-deuterioacetyl)oxy]-5-prop-2-enoxyoxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 139627234 |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,6-tris[(2-deuterioacetyl)oxy]-5-prop-2-enoxyoxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(OC(=O)C[2H])[C@H](OCC=C)[C@@H](OC(=O)C[2H])[C@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C17H24O10/c1-6-7-22-16-15(25-11(4)20)14(24-10(3)19)13(8-23-9(2)18)27-17(16)26-12(5)21/h6,13-17H,1,7-8H2,2-5H3/t13-,14+,15+,16-,17?/m1/s1/i2D,3D,4D,5D |
| InChIKey | ZGQAJJJRJQCDQU-MFELFSRESA-N |
| XLogP | 0.27 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|