C16H22O12 — CID 141249183
2-[(3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-deuterioacetyl)oxymethyl]oxan-2-yl]oxyacetic acid (PubChem CID 141249183) has the molecular formula C16H22O12 and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-[(3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-deuterioacetyl)oxymethyl]oxan-2-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-deuterioacetyl)oxymethyl]oxan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 141249183 |
| Molecular Formula | C16H22O12 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[(3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-deuterioacetyl)oxymethyl]oxan-2-yl]oxyacetic acid |
| SMILES | [2H]CC(=O)OC[C@H]1OC(OCC(=O)O)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C16H22O12/c1-7(17)23-5-11-13(25-8(2)18)14(26-9(3)19)15(27-10(4)20)16(28-11)24-6-12(21)22/h11,13-16H,5-6H2,1-4H3,(H,21,22)/t11-,13-,14+,15-,16?/m1/s1/i1D,2D,3D,4D |
| InChIKey | TWWYGXIQWBPJMT-GACXJPTKSA-N |
| XLogP | -0.83 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|