C10H16O6 — CID 6428305
[(3R,4S,5S)-4-acetyloxy-5-methoxyoxan-3-yl] acetate (PubChem CID 6428305) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is [(3R,4S,5S)-4-acetyloxy-5-methoxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S)-4-acetyloxy-5-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 6428305 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [(3R,4S,5S)-4-acetyloxy-5-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1COC[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H16O6/c1-6(11)15-9-5-14-4-8(13-3)10(9)16-7(2)12/h8-10H,4-5H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | MVVNLUDKWSGDPL-AEJSXWLSSA-N |
| XLogP | -0.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |