About (4-hydroxyoxolan-3-yl) acetate
(4-hydroxyoxolan-3-yl) acetate (PubChem CID 14785283) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is (4-hydroxyoxolan-3-yl) acetate.
Molecular Properties
| Compound Name | (4-hydroxyoxolan-3-yl) acetate |
| PubChem CID | 14785283 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (4-hydroxyoxolan-3-yl) acetate |
| SMILES | CC(=O)OC1COCC1O |
| InChI | InChI=1S/C6H10O4/c1-4(7)10-6-3-9-2-5(6)8/h5-6,8H,2-3H2,1H3 |
| InChIKey | OUSGHEFRPKUEIA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxyoxolan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyoxolan-3-yl) acetate?
The IUPAC name of (4-hydroxyoxolan-3-yl) acetate (CID 14785283) is (4-hydroxyoxolan-3-yl) acetate.
What is the SMILES notation for (4-hydroxyoxolan-3-yl) acetate?
The canonical SMILES for (4-hydroxyoxolan-3-yl) acetate is CC(=O)OC1COCC1O.
What is the InChIKey of (4-hydroxyoxolan-3-yl) acetate?
The InChIKey is OUSGHEFRPKUEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-4(7)10-6-3-9-2-5(6)8/h5-6,8H,2-3H2,1H3.
What are the key properties of (4-hydroxyoxolan-3-yl) acetate?
(4-hydroxyoxolan-3-yl) acetate has a molecular weight of 146.14 g/mol, XLogP of -0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyoxolan-3-yl) acetate is sourced from PubChem (CID 14785283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).