About [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate
[(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate (PubChem CID 67582047) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate.
Molecular Properties
| Compound Name | [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate |
| PubChem CID | 67582047 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H14O5/c1-5(10)13-8-3-7(12)4-9(8)14-6(2)11/h7-9,12H,3-4H2,1-2H3/t7?,8-,9+ |
| InChIKey | SIOLUXSHVSXSRI-CBLAIPOGSA-N |
| XLogP | 0.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate?
The IUPAC name of [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate (CID 67582047) is [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate.
What is the SMILES notation for [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate?
The canonical SMILES for [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate is CC(=O)O[C@H]1CC(O)C[C@H]1OC(C)=O.
What is the InChIKey of [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate?
The InChIKey is SIOLUXSHVSXSRI-CBLAIPOGSA-N. The full InChI is InChI=1S/C9H14O5/c1-5(10)13-8-3-7(12)4-9(8)14-6(2)11/h7-9,12H,3-4H2,1-2H3/t7?,8-,9+.
What are the key properties of [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate?
[(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate has a molecular weight of 202.21 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate is sourced from PubChem (CID 67582047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).