C9H14O5 — CID 67582047
[(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate (PubChem CID 67582047) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate.
| Compound Name | [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate |
|---|---|
| PubChem CID | 67582047 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | [(1S,2R)-2-acetyloxy-4-hydroxycyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H14O5/c1-5(10)13-8-3-7(12)4-9(8)14-6(2)11/h7-9,12H,3-4H2,1-2H3/t7?,8-,9+ |
| InChIKey | SIOLUXSHVSXSRI-CBLAIPOGSA-N |
| XLogP | 0.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |