About [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate
[(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate (PubChem CID 10678468) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate.
Analyze [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate?
The IUPAC name of [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate (CID 10678468) is [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate.
What is the SMILES notation for [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate?
The canonical SMILES for [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate is CC(=O)O[C@@H]1C[C@H](O)[C@H]2C[C@H]21.
What is the InChIKey of [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate?
The InChIKey is LCDAUHCMSYLFIY-FKSUSPILSA-N. The full InChI is InChI=1S/C8H12O3/c1-4(9)11-8-3-7(10)5-2-6(5)8/h5-8,10H,2-3H2,1H3/t5-,6+,7-,8+/m0/s1.
What are the key properties of [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate?
[(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate has a molecular weight of 156.18 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R,4S,5S)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] acetate is sourced from PubChem (CID 10678468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).