C17H26O6 — CID 23158088
(6-acetyloxy-3,7-dihydroxy-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-2-yl) acetate (PubChem CID 23158088) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (6-acetyloxy-3,7-dihydroxy-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-2-yl) acetate.
| Compound Name | (6-acetyloxy-3,7-dihydroxy-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-2-yl) acetate |
|---|---|
| PubChem CID | 23158088 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (6-acetyloxy-3,7-dihydroxy-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-2-yl) acetate |
| SMILES | CC(=O)OC1CC2CC3CC(O)C(OC(C)=O)CC3C2CC1O |
| InChI | InChI=1S/C17H26O6/c1-8(18)22-16-5-11-3-10-4-14(20)17(23-9(2)19)7-13(10)12(11)6-15(16)21/h10-17,20-21H,3-7H2,1-2H3 |
| InChIKey | JDMDERHLOVJVMO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |