C13H18O8 — CID 101209546
[(1R,2R,3R,4R)-2,3,4-triacetyloxycyclopentyl] acetate (PubChem CID 101209546) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-2,3,4-triacetyloxycyclopentyl] acetate.
| Compound Name | [(1R,2R,3R,4R)-2,3,4-triacetyloxycyclopentyl] acetate |
|---|---|
| PubChem CID | 101209546 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [(1R,2R,3R,4R)-2,3,4-triacetyloxycyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18O8/c1-6(14)18-10-5-11(19-7(2)15)13(21-9(4)17)12(10)20-8(3)16/h10-13H,5H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | OTFIJXTWPQTDSF-FDYHWXHSSA-N |
| XLogP | 0.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|