C15H22O8 — CID 170294536
[(1S,2R,3R,4R,5R)-2,3,4-triacetyloxy-5-methylcyclohexyl] acetate (PubChem CID 170294536) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5R)-2,3,4-triacetyloxy-5-methylcyclohexyl] acetate.
| Compound Name | [(1S,2R,3R,4R,5R)-2,3,4-triacetyloxy-5-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 170294536 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(1S,2R,3R,4R,5R)-2,3,4-triacetyloxy-5-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)C[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O8/c1-7-6-12(20-8(2)16)14(22-10(4)18)15(23-11(5)19)13(7)21-9(3)17/h7,12-15H,6H2,1-5H3/t7-,12+,13-,14-,15-/m1/s1 |
| InChIKey | LRWUCKKWSNZMHK-BDJQBZAYSA-N |
| XLogP | 0.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|