C10H15BrO5 — CID 10891746
[(2S,3R,4S)-3-acetyloxy-6-bromo-2-methyloxan-4-yl] acetate (PubChem CID 10891746) has the molecular formula C10H15BrO5 and a molecular weight of 295.13 g/mol. Its IUPAC name is [(2S,3R,4S)-3-acetyloxy-6-bromo-2-methyloxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S)-3-acetyloxy-6-bromo-2-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 10891746 |
| Molecular Formula | C10H15BrO5 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | [(2S,3R,4S)-3-acetyloxy-6-bromo-2-methyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)OC(Br)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H15BrO5/c1-5-10(16-7(3)13)8(15-6(2)12)4-9(11)14-5/h5,8-10H,4H2,1-3H3/t5-,8-,9?,10+/m0/s1 |
| InChIKey | DCYXHMVVTCMQQC-BOMAFOMESA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|