C12H19BrO7 — CID 166154369
[(3S,6R)-3-acetyloxy-6-bromo-2-formyloxan-4-yl] acetate;methoxymethane (PubChem CID 166154369) has the molecular formula C12H19BrO7 and a molecular weight of 355.18 g/mol. Its IUPAC name is [(3S,6R)-3-acetyloxy-6-bromo-2-formyloxan-4-yl] acetate;methoxymethane.
| Compound Name | [(3S,6R)-3-acetyloxy-6-bromo-2-formyloxan-4-yl] acetate;methoxymethane |
|---|---|
| PubChem CID | 166154369 |
| Molecular Formula | C12H19BrO7 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [(3S,6R)-3-acetyloxy-6-bromo-2-formyloxan-4-yl] acetate;methoxymethane |
| SMILES | CC(=O)OC1C[C@@H](Br)OC(C=O)[C@H]1OC(C)=O.COC |
| InChI | InChI=1S/C10H13BrO6.C2H6O/c1-5(13)15-7-3-9(11)17-8(4-12)10(7)16-6(2)14;1-3-2/h4,7-10H,3H2,1-2H3;1-2H3/t7?,8?,9-,10-;/m0./s1 |
| InChIKey | ZBNDXBSDUDTFKR-UANYXRBSSA-N |
| XLogP | 0.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|