C11H16O8 — CID 129298889
methyl (5R)-4,5-diacetyloxy-6-hydroxyoxane-2-carboxylate (PubChem CID 129298889) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is methyl (5R)-4,5-diacetyloxy-6-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (5R)-4,5-diacetyloxy-6-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 129298889 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | methyl (5R)-4,5-diacetyloxy-6-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)C1CC(OC(C)=O)[C@@H](OC(C)=O)C(O)O1 |
| InChI | InChI=1S/C11H16O8/c1-5(12)17-7-4-8(10(14)16-3)19-11(15)9(7)18-6(2)13/h7-9,11,15H,4H2,1-3H3/t7?,8?,9-,11?/m1/s1 |
| InChIKey | VXEOAMIWJPREAO-CHNYNBFLSA-N |
| XLogP | -0.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|