C9H13BrO5 — CID 10978872
[(2S,3R,4R,6R)-6-acetyl-3-bromo-2-hydroxyoxan-4-yl] acetate (PubChem CID 10978872) has the molecular formula C9H13BrO5 and a molecular weight of 281.10 g/mol. Its IUPAC name is [(2S,3R,4R,6R)-6-acetyl-3-bromo-2-hydroxyoxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,6R)-6-acetyl-3-bromo-2-hydroxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 10978872 |
| Molecular Formula | C9H13BrO5 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | [(2S,3R,4R,6R)-6-acetyl-3-bromo-2-hydroxyoxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](C(C)=O)O[C@H](O)[C@@H]1Br |
| InChI | InChI=1S/C9H13BrO5/c1-4(11)6-3-7(14-5(2)12)8(10)9(13)15-6/h6-9,13H,3H2,1-2H3/t6-,7-,8-,9+/m1/s1 |
| InChIKey | DQQCUHNLGRGWHR-BGZDPUMWSA-N |
| XLogP | 0.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|