C10H14BrFO5 — CID 101034415
[(2R,3R,4S,5S,6S)-4-acetyloxy-5-bromo-6-fluoro-2-methyloxan-3-yl] acetate (PubChem CID 101034415) has the molecular formula C10H14BrFO5 and a molecular weight of 313.12 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4-acetyloxy-5-bromo-6-fluoro-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-5-bromo-6-fluoro-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101034415 |
| Molecular Formula | C10H14BrFO5 |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-5-bromo-6-fluoro-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](Br)[C@H](F)O[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H14BrFO5/c1-4-8(16-5(2)13)9(17-6(3)14)7(11)10(12)15-4/h4,7-10H,1-3H3/t4-,7+,8-,9-,10-/m1/s1 |
| InChIKey | WAIZNOMESKZUDY-WVHNWXHQSA-N |
| XLogP | 1.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|