C16H20O5 — CID 10039969
[(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-phenyloxan-4-yl] acetate (PubChem CID 10039969) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-phenyloxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-phenyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 10039969 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-phenyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@H](c2ccccc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O5/c1-10-16(21-12(3)18)15(20-11(2)17)9-14(19-10)13-7-5-4-6-8-13/h4-8,10,14-16H,9H2,1-3H3/t10-,14-,15-,16-/m0/s1 |
| InChIKey | KJIRUYJIAMZJKL-MVWHLILJSA-N |
| XLogP | 2.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |