C23H26O5 — CID 10948955
[(2R,3S,4S,6S)-3-acetyloxy-2-benzhydryl-6-methyloxan-4-yl] acetate (PubChem CID 10948955) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2R,3S,4S,6S)-3-acetyloxy-2-benzhydryl-6-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,6S)-3-acetyloxy-2-benzhydryl-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 10948955 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(2R,3S,4S,6S)-3-acetyloxy-2-benzhydryl-6-methyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C[C@H](C)O[C@@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O5/c1-15-14-20(27-16(2)24)22(28-17(3)25)23(26-15)21(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,15,20-23H,14H2,1-3H3/t15-,20-,22-,23+/m0/s1 |
| InChIKey | BHSYOLBXOQVIRK-IINBLNPLSA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |