C17H26O4 — CID 158693531
(2,6-dimethyl-3-phenylmethoxyoxan-4-yl) acetate;methane (PubChem CID 158693531) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2,6-dimethyl-3-phenylmethoxyoxan-4-yl) acetate;methane.
| Compound Name | (2,6-dimethyl-3-phenylmethoxyoxan-4-yl) acetate;methane |
|---|---|
| PubChem CID | 158693531 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2,6-dimethyl-3-phenylmethoxyoxan-4-yl) acetate;methane |
| SMILES | C.CC(=O)OC1CC(C)OC(C)C1OCc1ccccc1 |
| InChI | InChI=1S/C16H22O4.CH4/c1-11-9-15(20-13(3)17)16(12(2)19-11)18-10-14-7-5-4-6-8-14;/h4-8,11-12,15-16H,9-10H2,1-3H3;1H4 |
| InChIKey | IGQNHXXNVSPLDK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |