C16H22O5 — CID 101175724
[(2S,3R,4S,6R)-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 101175724) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,6R)-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 101175724 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(2S,3R,4S,6R)-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](C)C[C@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O5/c1-11-9-14(19-10-13-7-5-4-6-8-13)15(21-12(2)17)16(18-3)20-11/h4-8,11,14-16H,9-10H2,1-3H3/t11-,14+,15-,16+/m1/s1 |
| InChIKey | ICBSUAHTSPTRRE-CAPXZKIUSA-N |
| XLogP | 2.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |