C23H28O5 — CID 174272359
[(2R,6R)-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 174272359) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is [(2R,6R)-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,6R)-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174272359 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(2R,6R)-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C)CC(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O5/c1-17-13-21(26-14-19-9-5-3-6-10-19)23(22(28-17)16-25-18(2)24)27-15-20-11-7-4-8-12-20/h3-12,17,21-23H,13-16H2,1-2H3/t17-,21?,22-,23?/m1/s1 |
| InChIKey | GYPBPBDWVHXAQM-GYMCATHZSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |